 | | 2W7 | | Name: | N-{2-oxo-2-[(3s,5s,7s)-tricyclo[3.3.1.1~3,7~]dec-1-ylamino]ethyl}-2-sulfanylbenzamide | | Formula: | C19 H24 N2 O2 S | | SMILES: | O=C(c1ccccc1S)NCC(=O)NC24CC3CC(CC(C2)C3)C4 | | InChi: | InChI=1S/C19H24N2O2S/c22-17(11-20-18(23)15-3-1-2-4-16(15)24)21-19-8-12-5-13(9-19)7-14(6-12)10-19/h1-4,12-14,24H,5-11H2,(H,20,23)(H,21,22)/t12-,13+,14-,19- | | Definition date: | 2014-03-06 | | Last modified: | 2024-09-27 | | Release date: | 2014-11-19 | | Identifier: | N-{2-oxo-2-[(3s,5s,7s)-tricyclo[3.3.1.1~3,7~]dec-1-ylamino]ethyl}-2-sulfanylbenzamide |
|
 | | 80U | | Name: | 1-[(3R)-3-[4-azanyl-3-[3-chloranyl-4-[(1-methylimidazol-2-yl)methoxy]phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]prop-2-en-1-one | | Formula: | C24 H25 Cl N8 O2 | | SMILES: | Cn1ccnc1COc2ccc(cc2Cl)c3nn([CH]4CCCN(C4)C(=O)C=C)c5ncnc(N)c35 | | InChi: | InChI=1S/C24H25ClN8O2/c1-3-20(34)32-9-4-5-16(12-32)33-24-21(23(26)28-14-29-24)22(30-33)15-6-7-18(17(25)11-15)35-13-19-27-8-10-31(19)2/h3,6-8,10-11,14,16H,1,4-5,9,12-13H2,2H3,(H2,26,28,29)/t16-/m1/s1 | | Definition date: | 2017-03-10 | | Last modified: | 2024-09-27 | | Release date: | 2017-04-02 | | Identifier: | 1-[(3~{R})-3-[4-azanyl-3-[3-chloranyl-4-[(1-methylimidazol-2-yl)methoxy]phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]prop-2-en-1-one |
|
 | | 80V | | Name: | 4-[6-({4-[(fluorosulfonyl)oxy]phenyl}ethynyl)-4,4-dimethyl-3,4-dihydroquinolin-1(2H)-yl]-4-oxobutanoic acid | | Formula: | C23 H22 F N O6 S | | SMILES: | FS(=O)(=O)Oc1ccc(cc1)C#Cc1ccc2c(c1)C(C)(C)CCN2C(=O)CCC(=O)O | | InChi: | InChI=1S/C23H22FNO6S/c1-23(2)13-14-25(21(26)11-12-22(27)28)20-10-7-17(15-19(20)23)4-3-16-5-8-18(9-6-16)31-32(24,29)30/h5-10,15H,11-14H2,1-2H3,(H,27,28) | | Definition date: | 2021-08-25 | | Last modified: | 2024-09-27 | | Release date: | 2021-12-15 | | Identifier: | 4-[6-({4-[(fluorosulfonyl)oxy]phenyl}ethynyl)-4,4-dimethyl-3,4-dihydroquinolin-1(2H)-yl]-4-oxobutanoic acid |
|
 | | 80Y | | Name: | 2-azanylethyl [(2R,3S,4S,5S,6S)-3,4,5,6-tetrakis(oxidanyl)oxan-2-yl]methyl hydrogen phosphate | | Formula: | C8 H18 N O9 P | | SMILES: | NCCO[P](O)(=O)OC[CH]1O[CH](O)[CH](O)[CH](O)[CH]1O | | InChi: | InChI=1S/C8H18NO9P/c9-1-2-16-19(14,15)17-3-4-5(10)6(11)7(12)8(13)18-4/h4-8,10-13H,1-3,9H2,(H,14,15)/t4-,5-,6+,7+,8+/m1/s1 | | Definition date: | 2023-03-15 | | Last modified: | 2024-09-27 | | Release date: | 2023-08-16 | | Identifier: | 2-azanylethyl [(2~{R},3~{S},4~{S},5~{S},6~{S})-3,4,5,6-tetrakis(oxidanyl)oxan-2-yl]methyl hydrogen phosphate |
|
 | | 816 | | Name: | 1-[(3R)-3-[4-azanyl-3-[3-chloranyl-4-[(6-methylpyridin-2-yl)methoxy]phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]prop-2-en-1-one | | Formula: | C26 H26 Cl N7 O2 | | SMILES: | Cc1cccc(COc2ccc(cc2Cl)c3nn([CH]4CCCN(C4)C(=O)C=C)c5ncnc(N)c35)n1 | | InChi: | InChI=1S/C26H26ClN7O2/c1-3-22(35)33-11-5-8-19(13-33)34-26-23(25(28)29-15-30-26)24(32-34)17-9-10-21(20(27)12-17)36-14-18-7-4-6-16(2)31-18/h3-4,6-7,9-10,12,15,19H,1,5,8,11,13-14H2,2H3,(H2,28,29,30)/t19-/m1/s1 | | Definition date: | 2017-03-15 | | Last modified: | 2024-09-27 | | Release date: | 2017-09-06 | | Identifier: | 1-[(3~{R})-3-[4-azanyl-3-[3-chloranyl-4-[(6-methylpyridin-2-yl)methoxy]phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]prop-2-en-1-one |
|
 | | 81C | | Name: | N-[5-[[5-chloranyl-4-[(2-propan-2-ylsulfonylphenyl)amino]pyrimidin-2-yl]amino]-2-(4-ethylpiperazin-1-yl)-4-methoxy-phenyl]prop-2-enamide | | Formula: | C29 H36 Cl N7 O4 S | | SMILES: | CCN1CCN(CC1)c2cc(OC)c(Nc3ncc(Cl)c(Nc4ccccc4[S](=O)(=O)C(C)C)n3)cc2NC(=O)C=C | | InChi: | InChI=1S/C29H36ClN7O4S/c1-6-27(38)32-22-16-23(25(41-5)17-24(22)37-14-12-36(7-2)13-15-37)34-29-31-18-20(30)28(35-29)33-21-10-8-9-11-26(21)42(39,40)19(3)4/h6,8-11,16-19H,1,7,12-15H2,2-5H3,(H,32,38)(H2,31,33,34,35) | | Definition date: | 2017-03-15 | | Last modified: | 2024-09-27 | | Release date: | 2017-09-06 | | Identifier: | ~{N}-[5-[[5-chloranyl-4-[(2-propan-2-ylsulfonylphenyl)amino]pyrimidin-2-yl]amino]-2-(4-ethylpiperazin-1-yl)-4-methoxy-phenyl]prop-2-enamide |
|
 | | 81L | | Name: | N-[(benzyloxy)carbonyl]-3-methyl-L-valyl-3-cyclopropyl-N-{(2S)-1-hydroxy-3-[(3S)-2-oxopyrrolidin-3-yl]propan-2-yl}-L-alaninamide | | Formula: | C27 H40 N4 O6 | | SMILES: | CC(C)(C)C(NC(=O)OCc1ccccc1)C(=O)NC(CC1CC1)C(=O)NC(CC1CCNC1=O)CO | | InChi: | InChI=1S/C27H40N4O6/c1-27(2,3)22(31-26(36)37-16-18-7-5-4-6-8-18)25(35)30-21(13-17-9-10-17)24(34)29-20(15-32)14-19-11-12-28-23(19)33/h4-8,17,19-22,32H,9-16H2,1-3H3,(H,28,33)(H,29,34)(H,30,35)(H,31,36)/t19-,20-,21-,22+/m0/s1 | | Definition date: | 2021-08-31 | | Last modified: | 2024-09-27 | | Release date: | 2022-07-20 | | Identifier: | N-[(benzyloxy)carbonyl]-3-methyl-L-valyl-3-cyclopropyl-N-{(2S)-1-hydroxy-3-[(3S)-2-oxopyrrolidin-3-yl]propan-2-yl}-L-alaninamide |
|
 | | 81R | | Name: | (4R)-4,5-disulfanyl-L-norvaline | | Formula: | C5 H11 N O2 S2 | | SMILES: | O=C(O)C(N)CC(S)CS | | InChi: | InChI=1S/C5H11NO2S2/c6-4(5(7)8)1-3(10)2-9/h3-4,9-10H,1-2,6H2,(H,7,8)/t3-,4+/m1/s1 | | Definition date: | 2014-02-19 | | Last modified: | 2024-09-27 | | Release date: | 2014-09-24 | | Identifier: | (4R)-4,5-disulfanyl-L-norvaline |
|
 | | 81S | | Name: | (4S)-4,5-disulfanyl-L-norvaline | | Formula: | C5 H11 N O2 S2 | | SMILES: | O=C(O)C(N)CC(S)CS | | InChi: | InChI=1S/C5H11NO2S2/c6-4(5(7)8)1-3(10)2-9/h3-4,9-10H,1-2,6H2,(H,7,8)/t3-,4-/m0/s1 | | Definition date: | 2014-02-19 | | Last modified: | 2024-09-27 | | Release date: | 2014-09-24 | | Identifier: | (4S)-4,5-disulfanyl-L-norvaline |
|
 | | 81T | | Name: | ~{N}-[(3~{R})-2,2,5,5-tetramethyl-1-oxidanyl-pyrrolidin-3-yl]ethanamide | | Formula: | C10 H20 N2 O2 | | SMILES: | CC(=O)N[CH]1CC(C)(C)N(O)C1(C)C | | InChi: | InChI=1S/C10H20N2O2/c1-7(13)11-8-6-9(2,3)12(14)10(8,4)5/h8,14H,6H2,1-5H3,(H,11,13)/t8-/m1/s1 | | Definition date: | 2021-09-27 | | Last modified: | 2024-09-27 | | Release date: | 2022-07-20 | | Identifier: | ~{N}-[(3~{R})-2,2,5,5-tetramethyl-1-oxidanyl-pyrrolidin-3-yl]ethanamide |
|
 | | 2XG | | Name: | 3,4-difluorobenzenethiol | | Formula: | C6 H4 F2 S | | SMILES: | Fc1ccc(S)cc1F | | InChi: | InChI=1S/C6H4F2S/c7-5-2-1-4(9)3-6(5)8/h1-3,9H | | Definition date: | 2014-04-04 | | Last modified: | 2024-09-27 | | Release date: | 2014-09-10 | | Identifier: | 3,4-difluorobenzenethiol |
|
 | | 2XH | | Name: | naphthalene-1-thiol | | Formula: | C10 H8 S | | SMILES: | Sc2cccc1ccccc12 | | InChi: | InChI=1S/C10H8S/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-7,11H | | Definition date: | 2014-04-07 | | Last modified: | 2024-09-27 | | Release date: | 2014-09-10 | | Identifier: | naphthalene-1-thiol |
|
 | | 2XI | | Name: | (2~{R})-~{N}-[(1~{R})-2-(~{tert}-butylamino)-2-oxidanylidene-1-pyridin-3-yl-ethyl]-~{N}-(4-~{tert}-butylphenyl)-2-oxidanyl-propanamide | | Formula: | C24 H33 N3 O3 | | SMILES: | C[CH](O)C(=O)N([CH](C(=O)NC(C)(C)C)c1cccnc1)c2ccc(cc2)C(C)(C)C | | InChi: | InChI=1S/C24H33N3O3/c1-16(28)22(30)27(19-12-10-18(11-13-19)23(2,3)4)20(17-9-8-14-25-15-17)21(29)26-24(5,6)7/h8-16,20,28H,1-7H3,(H,26,29)/t16-,20-/m1/s1 | | Definition date: | 2021-07-09 | | Last modified: | 2024-09-27 | | Release date: | 2021-07-21 | | Identifier: | (2~{R})-~{N}-[(1~{R})-2-(~{tert}-butylamino)-2-oxidanylidene-1-pyridin-3-yl-ethyl]-~{N}-(4-~{tert}-butylphenyl)-2-oxidanyl-propanamide |
|
 | | 821 | | Name: | [4-((1Z)-2-(ACETYLAMINO)-3-{[1-(1,1'-BIPHENYL-4-YLMETHYL)-2-OXOAZEPAN-3-YL]AMINO}-3-OXOPROP-1-ENYL)-2-FORMYLPHENYL]ACET
IC ACID | | Formula: | C33 H33 N3 O6 | | SMILES: | O=C(O)Cc1ccc(cc1C=O)C=C(/NC(=O)C)C(=O)NC4C(=O)N(Cc3ccc(c2ccccc2)cc3)CCCC4 | | InChi: | InChI=1S/C33H33N3O6/c1-22(38)34-30(18-24-12-15-27(19-31(39)40)28(17-24)21-37)32(41)35-29-9-5-6-16-36(33(29)42)20-23-10-13-26(14-11-23)25-7-3-2-4-8-25/h2-4,7-8,10-15,17-18,21,29H,5-6,9,16,19-20H2,1H3,(H,34,38)(H,35,41)(H,39,40)/b30-18-/t29-/m0/s1 | | Synonyms: | RU82129 | | Definition date: | 2003-06-20 | | Last modified: | 2024-09-27 | | Identifier: | {4-[(1Z)-2-(acetylamino)-3-{[(3S)-1-(biphenyl-4-ylmethyl)-2-oxoazepan-3-yl]amino}-3-oxoprop-1-en-1-yl]-2-formylphenyl}acetic acid |
|
 | | 823 | | Name: | N,N-bis(3-sulfanylpropyl)-L-asparagine | | Formula: | C10 H20 N2 O3 S2 | | SMILES: | O=C(O)C(N)CC(=O)N(CCCS)CCCS | | InChi: | InChI=1S/C10H20N2O3S2/c11-8(10(14)15)7-9(13)12(3-1-5-16)4-2-6-17/h8,16-17H,1-7,11H2,(H,14,15)/t8-/m0/s1 | | Definition date: | 2014-02-19 | | Last modified: | 2024-09-27 | | Release date: | 2014-09-24 | | Identifier: | N,N-bis(3-sulfanylpropyl)-L-asparagine |
|
 | | 2XO | | Name: | 1H-benzimidazol-2-ylmethanethiol | | Formula: | C8 H8 N2 S | | SMILES: | n2c1ccccc1nc2CS | | InChi: | InChI=1S/C8H8N2S/c11-5-8-9-6-3-1-2-4-7(6)10-8/h1-4,11H,5H2,(H,9,10) | | Definition date: | 2014-04-08 | | Last modified: | 2024-09-27 | | Release date: | 2014-09-10 | | Identifier: | 1H-benzimidazol-2-ylmethanethiol |
|
 | | 2XR | | Name: | 2-chloro-1-(1H-indol-3-yl)ethanone | | Formula: | C10 H8 Cl N O | | SMILES: | ClCC(=O)c2c1ccccc1nc2 | | InChi: | InChI=1S/C10H8ClNO/c11-5-10(13)8-6-12-9-4-2-1-3-7(8)9/h1-4,6,12H,5H2 | | Definition date: | 2014-04-08 | | Last modified: | 2024-09-27 | | Release date: | 2014-09-10 | | Identifier: | 2-chloro-1-(1H-indol-3-yl)ethanone |
|
 | | 82Q | | Name: | (2~{R},4~{R})-1-ethanoyl-~{N}-naphthalen-1-yl-4-phenyl-pyrrolidine-2-carboxamide | | Formula: | C23 H22 N2 O2 | | SMILES: | CC(=O)N1C[CH](C[CH]1C(=O)Nc2cccc3ccccc23)c4ccccc4 | | InChi: | InChI=1S/C23H22N2O2/c1-16(26)25-15-19(17-8-3-2-4-9-17)14-22(25)23(27)24-21-13-7-11-18-10-5-6-12-20(18)21/h2-13,19,22H,14-15H2,1H3,(H,24,27)/t19-,22+/m0/s1 | | Definition date: | 2021-09-28 | | Last modified: | 2024-09-27 | | Release date: | 2022-10-05 | | Identifier: | (2~{R},4~{R})-1-ethanoyl-~{N}-naphthalen-1-yl-4-phenyl-pyrrolidine-2-carboxamide |
|
 | | 2YD | | Name: | (5R,6R,7S,8R,9R,12S,13E,16S,18S,19R,20aR)-4,7,19-trihydroxy-2,6,8,12,14,16,18-heptamethyl-6,7,8,9,10,11,12,15,16,17,18,19,20,20a-tetradecahydro-1,19:5,9-diepoxybenzo[18]annulen-3(5H)-one | | Formula: | C29 H44 O6 | | SMILES: | O=C1C(=C2OC3(O)C(CC(CC(=CC(C)CCC4OC(C(=C1O)C2C3)C(C)C(O)C4C)C)C)C)C | | InChi: | InChI=1S/C29H44O6/c1-14-8-9-22-18(5)24(30)19(6)28(34-22)23-21-13-29(33,17(4)12-16(3)11-15(2)10-14)35-27(21)20(7)25(31)26(23)32/h10,14,16-19,21-22,24,28,30,32-33H,8-9,11-13H2,1-7H3/b15-10+/t14-,16+,17-,18-,19+,21+,22+,24-,28+,29+/m0/s1 | | Synonyms: | Kendomycin | | Definition date: | 2014-05-01 | | Last modified: | 2024-09-27 | | Release date: | 2014-07-30 | | Identifier: | (5R,6R,7S,8R,9R,12S,13E,16S,18S,19R,20aR)-4,7,19-trihydroxy-2,6,8,12,14,16,18-heptamethyl-6,7,8,9,10,11,12,15,16,17,18,19,20,20a-tetradecahydro-1,19:5,9-diepoxybenzo[18]annulen-3(5H)-one |
|
 | | 2YI | | Name: | methyl 3-[4-[(4-bromophenyl)methyl]piperazin-1-yl]carbonyl-5-[(2-ethyl-2-methanoyl-butanoyl)amino]benzoate | | Formula: | C27 H32 Br N3 O5 | | SMILES: | CCC(CC)(C=O)C(=O)Nc1cc(cc(c1)C(=O)N2CCN(CC2)Cc3ccc(Br)cc3)C(=O)OC | | InChi: | InChI=1S/C27H32BrN3O5/c1-4-27(5-2,18-32)26(35)29-23-15-20(14-21(16-23)25(34)36-3)24(33)31-12-10-30(11-13-31)17-19-6-8-22(28)9-7-19/h6-9,14-16,18H,4-5,10-13,17H2,1-3H3,(H,29,35) | | Definition date: | 2021-06-23 | | Last modified: | 2024-09-27 | | Release date: | 2021-07-07 | | Identifier: | methyl 3-[4-[(4-bromophenyl)methyl]piperazin-1-yl]carbonyl-5-[(2-ethyl-2-methanoyl-butanoyl)amino]benzoate |
|
 | | 2YR | | Name: | 2'-deoxy-N-(2-sulfanylethyl)cytidine 5'-(dihydrogen phosphate) | | Formula: | C11 H18 N3 O7 P S | | SMILES: | O=P(O)(O)OCC2OC(N1C(=O)N=C(NCCS)C=C1)CC2O | | InChi: | InChI=1S/C11H18N3O7PS/c15-7-5-10(21-8(7)6-20-22(17,18)19)14-3-1-9(12-2-4-23)13-11(14)16/h1,3,7-8,10,15,23H,2,4-6H2,(H,12,13,16)(H2,17,18,19)/t7-,8+,10+/m0/s1 | | Definition date: | 2014-04-28 | | Last modified: | 2024-09-27 | | Release date: | 2014-05-21 | | Identifier: | 2'-deoxy-N-(2-sulfanylethyl)cytidine 5'-(dihydrogen phosphate) |
|
 | | 2YS | | Name: | D-valyl-N-[(2S,3S)-7-amino-1-chloro-2-hydroxyheptan-3-yl]-L-leucinamide | | Formula: | C18 H37 Cl N4 O3 | | SMILES: | O=C(NC(CCCCN)C(O)CCl)C(NC(=O)C(N)C(C)C)CC(C)C | | InChi: | InChI=1S/C18H37ClN4O3/c1-11(2)9-14(23-18(26)16(21)12(3)4)17(25)22-13(15(24)10-19)7-5-6-8-20/h11-16,24H,5-10,20-21H2,1-4H3,(H,22,25)(H,23,26)/t13-,14-,15+,16+/m0/s1 | | Synonyms: | D-VAL-LEU-LYS-chloromethylketone | | Definition date: | 2014-04-29 | | Last modified: | 2024-09-27 | | Release date: | 2014-09-03 | | Identifier: | D-valyl-N-[(2S,3S)-7-amino-1-chloro-2-hydroxyheptan-3-yl]-L-leucinamide |
|
 | | 2YT | | Name: | L-phenylalanyl-N-[(2S,3S)-6-carbamimidamido-1-chloro-2-hydroxyhexan-3-yl]-L-phenylalaninamide | | Formula: | C25 H35 Cl N6 O3 | | SMILES: | ClCC(O)C(NC(=O)C(NC(=O)C(N)Cc1ccccc1)Cc2ccccc2)CCCNC(=[N@H])N | | InChi: | InChI=1S/C25H35ClN6O3/c26-16-22(33)20(12-7-13-30-25(28)29)31-24(35)21(15-18-10-5-2-6-11-18)32-23(34)19(27)14-17-8-3-1-4-9-17/h1-6,8-11,19-22,33H,7,12-16,27H2,(H,31,35)(H,32,34)(H4,28,29,30)/t19-,20-,21-,22+/m0/s1 | | Synonyms: | PHE-PHE-ARG-chloromethylketone | | Definition date: | 2014-04-29 | | Last modified: | 2024-09-27 | | Release date: | 2014-09-03 | | Identifier: | L-phenylalanyl-N-[(2S,3S)-6-carbamimidamido-1-chloro-2-hydroxyhexan-3-yl]-L-phenylalaninamide |
|
 | | 83E | | Name: | N,N-dimethyl-L-valyl-L-leucyl-N-[(3S)-6-{(2S)-2-[([1,1'-biphenyl]-4-yl)methyl]-3-methoxy-5-oxo-2,5-dihydro-1H-pyrrol-1-yl}-6-oxo-1-phenylhexan-3-yl]-L-leucinamide | | Formula: | C49 H67 N5 O6 | | SMILES: | O=C(CCC(CCc1ccccc1)NC(=O)C(CC(C)C)NC(=O)C(CC(C)C)NC(=O)C(C(C)C)N(C)C)N1C(=O)C=C(OC)C1Cc1ccc(cc1)c1ccccc1 | | InChi: | InChI=1S/C49H67N5O6/c1-32(2)28-40(51-48(58)41(29-33(3)4)52-49(59)46(34(5)6)53(7)8)47(57)50-39(25-22-35-16-12-10-13-17-35)26-27-44(55)54-42(43(60-9)31-45(54)56)30-36-20-23-38(24-21-36)37-18-14-11-15-19-37/h10-21,23-24,31-34,39-42,46H,22,25-30H2,1-9H3,(H,50,57)(H,51,58)(H,52,59)/t39-,40-,41-,42-,46-/m0/s1 | | Definition date: | 2021-09-03 | | Last modified: | 2024-09-27 | | Release date: | 2022-03-02 | | Identifier: | N,N-dimethyl-L-valyl-L-leucyl-N-[(3S)-6-{(2S)-2-[([1,1'-biphenyl]-4-yl)methyl]-3-methoxy-5-oxo-2,5-dihydro-1H-pyrrol-1-yl}-6-oxo-1-phenylhexan-3-yl]-L-leucinamide |
|
 | | 83F | | Name: | tert-butyl-N-[(2S)-3-methyl-1-[(2S,4S)-4-methyl-2-[[(2S)-1-oxidanyl-3-[(3S)-2-oxidanylidenepyrrolidin-3-yl]propan-2-yl]carbamoyl]pyrrolidin-1-yl]-1-oxidanylidene-butan-2-yl]carbamate | | Formula: | C23 H40 N4 O6 | | SMILES: | CC(C)[CH](NC(=O)OC(C)(C)C)C(=O)N1C[CH](C)C[CH]1C(=O)N[CH](CO)C[CH]2CCNC2=O | | InChi: | InChI=1S/C23H40N4O6/c1-13(2)18(26-22(32)33-23(4,5)6)21(31)27-11-14(3)9-17(27)20(30)25-16(12-28)10-15-7-8-24-19(15)29/h13-18,28H,7-12H2,1-6H3,(H,24,29)(H,25,30)(H,26,32)/t14-,15-,16-,17-,18-/m0/s1 | | Synonyms: | tert-butyl N-[(2S)-3-methyl-1-[(2S,4S)-4-methyl-2-[[(2S)-1-oxidanylidene-3-[(3S)-2-oxidanylidenepyrrolidin-3-yl]propan-2-yl]carbamoyl]pyrrolidin-1-yl]-1-oxidanylidene-butan-2-yl]carbamate | | Definition date: | 2021-09-30 | | Last modified: | 2024-09-27 | | Release date: | 2023-05-03 | | Identifier: | ~{tert}-butyl ~{N}-[(2~{S})-3-methyl-1-[(2~{S},4~{S})-4-methyl-2-[[(2~{S})-1-oxidanyl-3-[(3~{S})-2-oxidanylidenepyrrolidin-3-yl]propan-2-yl]carbamoyl]pyrrolidin-1-yl]-1-oxidanylidene-butan-2-yl]carbamate |
|