7G70
Crystal Structure of rat Autotaxin in complex with [(3aS,6aS)-5-[2-(dimethylamino)-6-(oxan-4-ylmethoxy)pyridine-4-carbonyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-(1H-benzotriazol-5-yl)methanone, i.e. SMILES c1(ccc2c(c1)N=NN2)C(=O)N1C[C@@H]2[C@@H](C1)CN(C2)C(=O)c1cc(nc(c1)OCC1CCOCC1)N(C)C with IC50=0.0094279 microM
Experimental procedure
| Experimental method | SINGLE WAVELENGTH |
| Source type | SYNCHROTRON |
| Source details | SLS BEAMLINE X10SA |
| Synchrotron site | SLS |
| Beamline | X10SA |
| Temperature [K] | 100 |
| Detector technology | PIXEL |
| Collection date | 2014-06-09 |
| Detector | PSI PILATUS 6M |
| Wavelength(s) | 0.999870 |
| Spacegroup name | P 21 21 21 |
| Unit cell lengths | 84.438, 92.042, 120.427 |
| Unit cell angles | 90.00, 90.00, 90.00 |
Refinement procedure
| Resolution | 46.020 - 1.790 |
| R-factor | 0.2067 |
| Rwork | 0.205 |
| R-free | 0.24040 |
| Structure solution method | MOLECULAR REPLACEMENT |
| Starting model (for MR) | inhouse model |
| RMSD bond length | 0.012 |
| RMSD bond angle | 1.569 |
| Data reduction software | XDS |
| Data scaling software | XSCALE |
| Phasing software | PHASER |
| Refinement software | REFMAC (5.8.0049) |
Data quality characteristics
| Overall | Inner shell | Outer shell | |
| Low resolution limit [Å] | 43.270 | 46.020 | 1.840 |
| High resolution limit [Å] | 1.790 | 8.010 | 1.790 |
| Rmerge | 0.138 | 0.053 | 2.436 |
| Rmeas | 0.150 | 0.058 | 2.631 |
| Total number of observations | 594656 | ||
| Number of reflections | 88996 | 1132 | 6514 |
| <I/σ(I)> | 8.82 | 30.85 | 0.77 |
| Completeness [%] | 99.9 | 99.1 | 100 |
| Redundancy | 6.682 | 6.269 | 6.911 |
| CC(1/2) | 0.997 | 0.996 | 0.291 |
Crystallization Conditions
| crystal ID | method | pH | temperature | details |
| 1 | VAPOR DIFFUSION, SITTING DROP | 4.5 | 293 | 15.3 mg/mL protein in 20mM BICINE/NaOH pH8.5, 150mM NaCl, 0.02% NaN3 mixed 50-70% with 50-30% reservoir consisting of 11-17% PEG3350, 0.1M Na-acetate pH4.5, 0.2M Ca-acetate, total volume 200nL |






