7G51
Crystal Structure of rat Autotaxin in complex with (5Z)-5-[(4-phenoxyphenyl)methylidene]-2-pyrrolidin-1-yl-1,3-thiazol-4-one, i.e. SMILES C\1(=C\c2ccc(Oc3ccccc3)cc2)/C(=O)N=C(S1)N1CCCC1 with IC50=0.135695 microM
Experimental procedure
| Experimental method | SINGLE WAVELENGTH |
| Source type | SYNCHROTRON |
| Source details | SLS BEAMLINE X10SA |
| Synchrotron site | SLS |
| Beamline | X10SA |
| Temperature [K] | 100 |
| Detector technology | PIXEL |
| Collection date | 2012-08-21 |
| Detector | PSI PILATUS 6M |
| Wavelength(s) | 0.999960 |
| Spacegroup name | P 21 21 21 |
| Unit cell lengths | 84.280, 92.206, 120.451 |
| Unit cell angles | 90.00, 90.00, 90.00 |
Refinement procedure
| Resolution | 46.100 - 2.120 |
| R-factor | 0.1847 |
| Rwork | 0.183 |
| R-free | 0.22140 |
| Structure solution method | MOLECULAR REPLACEMENT |
| Starting model (for MR) | inhouse model |
| Data reduction software | XDS |
| Data scaling software | XSCALE |
| Phasing software | PHASER |
| Refinement software | PHENIX (1.20.1_4487) |
Data quality characteristics
| Overall | Inner shell | Outer shell | |
| Low resolution limit [Å] | 46.100 | 46.100 | 2.180 |
| High resolution limit [Å] | 2.120 | 9.480 | 2.120 |
| Rmerge | 0.214 | 0.043 | 1.768 |
| Rmeas | 0.232 | 0.047 | 1.920 |
| Total number of observations | 356915 | ||
| Number of reflections | 53980 | 699 | 3916 |
| <I/σ(I)> | 7.54 | 29.32 | 1.08 |
| Completeness [%] | 100.0 | 98.7 | 100 |
| Redundancy | 6.612 | 6.263 | 6.559 |
| CC(1/2) | 0.993 | 0.999 | 0.414 |
Crystallization Conditions
| crystal ID | method | pH | temperature | details |
| 1 | VAPOR DIFFUSION, SITTING DROP | 4.5 | 293 | 15.3 mg/mL protein in 20mM BICINE/NaOH pH8.5, 150mM NaCl, 0.02% NaN3 mixed 50-70% with 50-30% reservoir consisting of 11-17% PEG3350, 0.1M Na-acetate pH4.5, 0.2M Ca-acetate, total volume 200nL |






