7G2N
Crystal Structure of rat Autotaxin in complex with 5-fluoro-6-[1-[3-[2-[(5-methyltetrazol-2-yl)methyl]-4-(trifluoromethyl)phenyl]propanoyl]piperidin-4-yl]sulfanylpyridine-3-sulfonamide, i.e. SMILES O=C(N1CC[C@@H](Sc2c(F)cc(S(=O)(=O)N)cn2)CC1)CCc1ccc(cc1CN1N=NC(=N1)C)C(F)(F)F with IC50=0.00881095 microM
Experimental procedure
| Experimental method | SINGLE WAVELENGTH |
| Source type | SYNCHROTRON |
| Source details | SLS BEAMLINE X10SA |
| Synchrotron site | SLS |
| Beamline | X10SA |
| Temperature [K] | 100 |
| Detector technology | PIXEL |
| Collection date | 2015-12-13 |
| Detector | PSI PILATUS 6M |
| Wavelength(s) | 0.999970 |
| Spacegroup name | P 21 21 21 |
| Unit cell lengths | 83.952, 91.409, 119.249 |
| Unit cell angles | 90.00, 90.00, 90.00 |
Refinement procedure
| Resolution | 48.610 - 2.400 |
| R-factor | 0.2015 |
| Rwork | 0.199 |
| R-free | 0.25880 |
| Structure solution method | MOLECULAR REPLACEMENT |
| Starting model (for MR) | inhouse model |
| RMSD bond length | 0.011 |
| RMSD bond angle | 1.509 |
| Data reduction software | XDS |
| Data scaling software | XSCALE |
| Phasing software | PHASER |
| Refinement software | REFMAC (5.8.0103) |
Data quality characteristics
| Overall | Inner shell | Outer shell | |
| Low resolution limit [Å] | 48.610 | 48.610 | 2.460 |
| High resolution limit [Å] | 2.400 | 10.730 | 2.400 |
| Rmerge | 0.146 | 0.025 | 1.800 |
| Rmeas | 0.159 | 0.028 | 1.980 |
| Total number of observations | 240432 | ||
| Number of reflections | 36603 | 479 | 2650 |
| <I/σ(I)> | 11.7 | 49.53 | 1 |
| Completeness [%] | 99.9 | 98.2 | 99.9 |
| Redundancy | 6.569 | 5.436 | 5.79 |
| CC(1/2) | 0.997 | 0.999 | 0.354 |
Crystallization Conditions
| crystal ID | method | pH | temperature | details |
| 1 | VAPOR DIFFUSION, SITTING DROP | 4.5 | 293 | 15.3 mg/mL protein in 20mM BICINE/NaOH pH8.5, 150mM NaCl, 0.02% NaN3 mixed 50-70% with 50-30% reservoir consisting of 11-17% PEG3350, 0.1M Na-acetate pH4.5, 0.2M Ca-acetate, total volume 200nL |






