7G1J
Crystal Structure of human FABP4 in complex with 2-[[3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-4,5-dimethylthiophen-2-yl]carbamoyl]cyclohexene-1-carboxylic acid, i.e. SMILES C1(=C(CCCC1)C(=O)NC1=C(C(=C(C)S1)C)C1=NC(=NO1)C1CC1)C(=O)O with IC50=0.0236791 microM
Experimental procedure
| Experimental method | SINGLE WAVELENGTH |
| Source type | SYNCHROTRON |
| Source details | SLS BEAMLINE X10SA |
| Synchrotron site | SLS |
| Beamline | X10SA |
| Temperature [K] | 100 |
| Detector technology | PIXEL |
| Collection date | 2012-01-31 |
| Detector | PSI PILATUS 6M |
| Wavelength(s) | 0.700010 |
| Spacegroup name | P 21 21 21 |
| Unit cell lengths | 32.372, 54.053, 75.123 |
| Unit cell angles | 90.00, 90.00, 90.00 |
Refinement procedure
| Resolution | 37.560 - 1.110 |
| R-factor | 0.1458 |
| Rwork | 0.144 |
| R-free | 0.17860 |
| Structure solution method | MOLECULAR REPLACEMENT |
| Starting model (for MR) | inhouse model |
| RMSD bond length | 0.023 |
| RMSD bond angle | 2.179 |
| Data reduction software | XDS |
| Data scaling software | XSCALE |
| Phasing software | PHASER |
| Refinement software | REFMAC (5.6.0119) |
Data quality characteristics
| Overall | Inner shell | Outer shell | |
| Low resolution limit [Å] | 37.560 | 37.560 | 1.140 |
| High resolution limit [Å] | 1.110 | 4.960 | 1.110 |
| Rmerge | 0.073 | 0.021 | 1.489 |
| Rmeas | 0.087 | 0.023 | 1.607 |
| Total number of observations | 348951 | ||
| Number of reflections | 52238 | 696 | 3743 |
| <I/σ(I)> | 12.55 | 62.28 | 1.25 |
| Completeness [%] | 98.1 | 98.6 | 96.7 |
| Redundancy | 6.58 | 6.21 | 6.966 |
| CC(1/2) | 1.000 | 0.999 | 0.552 |
Crystallization Conditions
| crystal ID | method | pH | temperature | details |
| 1 | VAPOR DIFFUSION, SITTING DROP | 7 | 293 | protein in 25mM Tris/HCl pH 7.5 100mM NaCl, see also PMID 27658368 |






