7G1B
Crystal Structure of human FABP4 in complex with 2-[1-[(3-chlorophenyl)methyl]indol-2-yl]cyclopropane-1-carboxylic acid, i.e. SMILES C1(=Cc2c(N1Cc1cc(ccc1)Cl)cccc2)[C@H]1[C@@H](C1)C(=O)O with IC50=0.155 microM
Experimental procedure
| Experimental method | SINGLE WAVELENGTH |
| Source type | SYNCHROTRON |
| Source details | SLS BEAMLINE X10SA |
| Synchrotron site | SLS |
| Beamline | X10SA |
| Temperature [K] | 100 |
| Detector technology | PIXEL |
| Collection date | 2010-06-25 |
| Detector | PSI PILATUS 6M |
| Wavelength(s) | 1.000000 |
| Spacegroup name | P 21 21 21 |
| Unit cell lengths | 32.545, 53.992, 75.074 |
| Unit cell angles | 90.00, 90.00, 90.00 |
Refinement procedure
| Resolution | 30.840 - 1.170 |
| R-factor | 0.1488 |
| Rwork | 0.147 |
| R-free | 0.17310 |
| Structure solution method | MOLECULAR REPLACEMENT |
| Starting model (for MR) | inhouse model |
| RMSD bond length | 0.016 |
| RMSD bond angle | 1.927 |
| Data reduction software | XDS |
| Data scaling software | XSCALE |
| Phasing software | PHASER |
| Refinement software | REFMAC (5.8.0403) |
Data quality characteristics
| Overall | Inner shell | Outer shell | |
| Low resolution limit [Å] | 30.820 | 30.840 | 1.200 |
| High resolution limit [Å] | 1.170 | 5.250 | 1.170 |
| Rmerge | 0.033 | 0.019 | 0.372 |
| Rmeas | 0.036 | 0.021 | 0.420 |
| Total number of observations | 272892 | ||
| Number of reflections | 44617 | 601 | 2878 |
| <I/σ(I)> | 24.06 | 62.21 | 3.76 |
| Completeness [%] | 98.8 | 99.3 | 87.6 |
| Redundancy | 6.116 | 6.065 | 4.421 |
| CC(1/2) | 1.000 | 0.999 | 0.914 |
Crystallization Conditions
| crystal ID | method | pH | temperature | details |
| 1 | VAPOR DIFFUSION, SITTING DROP | 7 | 293 | protein in 25mM Tris/HCl pH 7.5 100mM NaCl, see also PMID 27658368 |






