7FZX
Crystal Structure of human FABP4 in complex with (2S)-6-(4-chlorophenoxy)-2-(4-methylphenoxy)hexanoic acid, i.e. SMILES c1(O[C@@H](CCCCOc2ccc(cc2)Cl)C(=O)O)ccc(cc1)C with IC50=0.585 microM
Experimental procedure
| Experimental method | SINGLE WAVELENGTH |
| Source type | SYNCHROTRON |
| Source details | SLS BEAMLINE X10SA |
| Synchrotron site | SLS |
| Beamline | X10SA |
| Temperature [K] | 100 |
| Detector technology | PIXEL |
| Collection date | 2011-11-28 |
| Detector | PSI PILATUS 6M |
| Wavelength(s) | 0.700000 |
| Spacegroup name | P 21 21 21 |
| Unit cell lengths | 32.514, 53.749, 75.204 |
| Unit cell angles | 90.00, 90.00, 90.00 |
Refinement procedure
| Resolution | 43.730 - 1.070 |
| R-factor | 0.1488 |
| Rwork | 0.147 |
| R-free | 0.17790 |
| Structure solution method | MOLECULAR REPLACEMENT |
| Starting model (for MR) | inhouse model |
| RMSD bond length | 0.024 |
| RMSD bond angle | 2.244 |
| Data reduction software | XDS |
| Data scaling software | XSCALE |
| Phasing software | PHASER |
| Refinement software | REFMAC (5.6.0119) |
Data quality characteristics
| Overall | Inner shell | Outer shell | |
| Low resolution limit [Å] | 43.730 | 43.730 | 1.100 |
| High resolution limit [Å] | 1.070 | 4.790 | 1.070 |
| Rmerge | 0.063 | 0.023 | 1.349 |
| Rmeas | 0.073 | 0.026 | 1.465 |
| Total number of observations | 383987 | ||
| Number of reflections | 59037 | 781 | 4299 |
| <I/σ(I)> | 11.25 | 57.75 | 1.39 |
| Completeness [%] | 100.0 | 99.7 | 100 |
| Redundancy | 6.49 | 6.204 | 6.605 |
| CC(1/2) | 0.999 | 0.999 | 0.555 |
Crystallization Conditions
| crystal ID | method | pH | temperature | details |
| 1 | VAPOR DIFFUSION, SITTING DROP | 7 | 293 | protein in 25mM Tris/HCl pH 7.5 100mM NaCl, see also PMID 27658368 |






