7FY6
Crystal Structure of human FABP4 in complex with 6-phenyl-11H-pyrimido[4,5-c][2]benzazepin-3-amine, i.e. SMILES C1(=Nc2c(Cc3c1cccc3)cnc(n2)N)c1ccccc1 with IC50=1.4 microM
Experimental procedure
| Experimental method | SINGLE WAVELENGTH |
| Source type | SYNCHROTRON |
| Source details | SLS BEAMLINE X10SA |
| Synchrotron site | SLS |
| Beamline | X10SA |
| Temperature [K] | 100 |
| Detector technology | PIXEL |
| Collection date | 2011-12-08 |
| Detector | PSI PILATUS 6M |
| Wavelength(s) | 1.000020 |
| Spacegroup name | P 21 21 21 |
| Unit cell lengths | 32.669, 53.676, 75.262 |
| Unit cell angles | 90.00, 90.00, 90.00 |
Refinement procedure
| Resolution | 43.690 - 1.120 |
| R-factor | 0.1291 |
| Rwork | 0.127 |
| R-free | 0.16050 |
| Structure solution method | MOLECULAR REPLACEMENT |
| Starting model (for MR) | inhouse model |
| RMSD bond length | 0.026 |
| RMSD bond angle | 2.308 |
| Data reduction software | XDS |
| Data scaling software | XSCALE |
| Phasing software | PHASER |
| Refinement software | REFMAC (5.6.0119) |
Data quality characteristics
| Overall | Inner shell | Outer shell | |
| Low resolution limit [Å] | 43.700 | 43.690 | 1.150 |
| High resolution limit [Å] | 1.120 | 5.010 | 1.120 |
| Rmerge | 0.036 | 0.025 | 0.315 |
| Rmeas | 0.037 | 0.027 | 0.351 |
| Total number of observations | 314186 | ||
| Number of reflections | 51137 | 685 | 3240 |
| <I/σ(I)> | 20.99 | 60.24 | 4.87 |
| Completeness [%] | 99.1 | 99.4 | 86.8 |
| Redundancy | 6.15 | 6.02 | 4.88 |
| CC(1/2) | 0.999 | 0.999 | 0.941 |
Crystallization Conditions
| crystal ID | method | pH | temperature | details |
| 1 | VAPOR DIFFUSION, SITTING DROP | 7 | 293 | protein in 25mM Tris/HCl pH 7.5 100mM NaCl, see also PMID 27658368 |






