7FWP
Crystal Structure of human FABP4 in complex with 3-hydroxy-4-[3-(3-methoxyphenyl)propyl]-2-(2-phenylethyl)-2H-furan-5-one, i.e. SMILES COc1cccc(CCCC2=C(O)[C@@H](CCc3ccccc3)OC2=O)c1 with IC50=0.314 microM
Experimental procedure
| Experimental method | SINGLE WAVELENGTH |
| Source type | SYNCHROTRON |
| Source details | SLS BEAMLINE X10SA |
| Synchrotron site | SLS |
| Beamline | X10SA |
| Temperature [K] | 100 |
| Detector technology | PIXEL |
| Collection date | 2011-11-28 |
| Detector | PSI PILATUS 6M |
| Wavelength(s) | 0.700000 |
| Spacegroup name | P 21 21 21 |
| Unit cell lengths | 32.532, 53.730, 75.468 |
| Unit cell angles | 90.00, 90.00, 90.00 |
Refinement procedure
| Resolution | 37.740 - 1.030 |
| R-factor | 0.1734 |
| Rwork | 0.172 |
| R-free | 0.20550 |
| Structure solution method | MOLECULAR REPLACEMENT |
| Starting model (for MR) | inhouse model |
| RMSD bond length | 0.024 |
| RMSD bond angle | 2.377 |
| Data reduction software | XDS |
| Data scaling software | XSCALE |
| Phasing software | PHASER |
| Refinement software | REFMAC (5.6.0119) |
Data quality characteristics
| Overall | Inner shell | Outer shell | |
| Low resolution limit [Å] | 37.730 | 37.740 | 1.060 |
| High resolution limit [Å] | 1.030 | 4.610 | 1.030 |
| Rmerge | 0.141 | 0.050 | 1.885 |
| Rmeas | 0.108 | 0.055 | 2.077 |
| Total number of observations | 396592 | ||
| Number of reflections | 64632 | 866 | 4816 |
| <I/σ(I)> | 5.57 | 30.09 | 1.13 |
| Completeness [%] | 97.5 | 99.7 | 99.9 |
| Redundancy | 5.21 | 6.012 | 5.664 |
| CC(1/2) | 0.998 | 0.997 | 0.456 |
Crystallization Conditions
| crystal ID | method | pH | temperature | details |
| 1 | VAPOR DIFFUSION, SITTING DROP | 7 | 293 | protein in 25mM Tris/HCl pH 7.5 100mM NaCl, see also PMID 27658368 |






