5SKN
CRYSTAL STRUCTURE OF HUMAN PHOSPHODIESTERASE 10 IN COMPLEX WITH n1(nccc1C3=NN(c2cccc(c2)NC(=O)C)C=CC3=O)c4ccccc4F, micromolar IC50=0.021094
Experimental procedure
| Experimental method | SINGLE WAVELENGTH |
| Source type | SYNCHROTRON |
| Source details | SLS BEAMLINE X10SA |
| Synchrotron site | SLS |
| Beamline | X10SA |
| Temperature [K] | 100 |
| Detector technology | CCD |
| Collection date | 2009-04-14 |
| Detector | MARMOSAIC 225 mm CCD |
| Wavelength(s) | 1.000000 |
| Spacegroup name | H 3 |
| Unit cell lengths | 135.480, 135.480, 235.361 |
| Unit cell angles | 90.00, 90.00, 120.00 |
Refinement procedure
| Resolution | 35.030 - 1.900 |
| R-factor | 0.1928 |
| Rwork | 0.191 |
| R-free | 0.22240 |
| Structure solution method | MOLECULAR REPLACEMENT |
| Starting model (for MR) | inhouse model |
| RMSD bond length | 0.005 |
| RMSD bond angle | 1.284 |
| Data reduction software | XDS |
| Data scaling software | XSCALE |
| Phasing software | PHASER |
| Refinement software | REFMAC (5.8.0258) |
Data quality characteristics
| Overall | Inner shell | Outer shell | |
| Low resolution limit [Å] | 35.000 | 35.030 | 1.950 |
| High resolution limit [Å] | 1.900 | 8.500 | 1.900 |
| Rmerge | 0.052 | 0.023 | 1.110 |
| Rmeas | 0.061 | 0.027 | 1.380 |
| Total number of observations | 465604 | ||
| Number of reflections | 125596 | 1191 | 8600 |
| <I/σ(I)> | 15.26 | 47.76 | 1.09 |
| Completeness [%] | 98.9 | 84.2 | 91.5 |
| Redundancy | 3.707 | 3.531 | 2.571 |
| CC(1/2) | 0.999 | 0.998 | 0.422 |
Crystallization Conditions
| crystal ID | method | pH | temperature | details |
| 1 | VAPOR DIFFUSION, SITTING DROP | 7.5 | 295 | 5-20 mg/mL protein in 25mM HEPES/NaOH pH7.5, 150mM NaCl, 50mM BME mixed 1:1 with reservoir 0.1M HEPES/NaOH pH7.5, 30% PEG550MME, 50mM MgCl2 |






