5P8E
Automated refinement of diffraction data obtained from an endothiapepsin crystal treated with fragment 347
Experimental procedure
| Experimental method | SINGLE WAVELENGTH |
| Source type | SYNCHROTRON |
| Source details | BESSY BEAMLINE 14.2 |
| Synchrotron site | BESSY |
| Beamline | 14.2 |
| Temperature [K] | 100 |
| Detector technology | CCD |
| Collection date | 2014-06-04 |
| Detector | MARMOSAIC 225 mm CCD |
| Wavelength(s) | 0.91841 |
| Spacegroup name | P 1 21 1 |
| Unit cell lengths | 45.252, 73.004, 52.749 |
| Unit cell angles | 90.00, 109.42, 90.00 |
Refinement procedure
| Resolution | 29.430 - 1.219 |
| R-factor | 0.1326 |
| Rwork | 0.132 |
| R-free | 0.14980 |
| Structure solution method | MOLECULAR REPLACEMENT |
| Starting model (for MR) | 4y5l |
| RMSD bond length | 0.006 |
| RMSD bond angle | 1.198 |
| Data reduction software | XDS |
| Data scaling software | XDS |
| Phasing software | PHASER (2.5.7) |
| Refinement software | PHENIX |
Data quality characteristics
| Overall | Inner shell | Outer shell | |
| Low resolution limit [Å] | 42.677 | 1.290 | |
| High resolution limit [Å] | 1.220 | 3.650 | 1.220 |
| Rmerge | 0.051 | 0.014 | 0.625 |
| Rmeas | 0.058 | 0.017 | 0.718 |
| Total number of observations | 392915 | ||
| Number of reflections | 94816 | 3650 | 15067 |
| <I/σ(I)> | 17.88 | 73.39 | 2.18 |
| Completeness [%] | 98.6 | 98.7 | 97 |
| Redundancy | 4.143 | ||
| CC(1/2) | 1.000 | 1.000 | 0.737 |
Crystallization Conditions
| crystal ID | method | pH | temperature | details |
| 1 | VAPOR DIFFUSION, SITTING DROP | 4.6 | 290 | 0.1 M ammonium acetate, 0.1 M sodium acetate, 24-30% PEG 4000; crystal obtained by streak-seeding and soaked with 90 mM of fragment 347 with the SMILES code OC1=NC(=NC2=CC=CC=C12)C(=O)NCC1CC1 |






