5P77
Automated refinement of diffraction data obtained from an endothiapepsin crystal treated with fragment 304
Experimental procedure
| Experimental method | SINGLE WAVELENGTH |
| Source type | SYNCHROTRON |
| Source details | BESSY BEAMLINE 14.1 |
| Synchrotron site | BESSY |
| Beamline | 14.1 |
| Temperature [K] | 100 |
| Detector technology | PIXEL |
| Collection date | 2013-07-18 |
| Detector | DECTRIS PILATUS 6M |
| Wavelength(s) | 0.918409 |
| Spacegroup name | P 1 21 1 |
| Unit cell lengths | 45.265, 73.196, 52.609 |
| Unit cell angles | 90.00, 109.25, 90.00 |
Refinement procedure
| Resolution | 27.798 - 1.029 |
| R-factor | 0.1291 |
| Rwork | 0.128 |
| R-free | 0.14300 |
| Structure solution method | MOLECULAR REPLACEMENT |
| Starting model (for MR) | 4y5l |
| RMSD bond length | 0.006 |
| RMSD bond angle | 1.198 |
| Data reduction software | XDS |
| Data scaling software | XDS |
| Phasing software | PHASER (2.5.7) |
| Refinement software | PHENIX |
Data quality characteristics
| Overall | Inner shell | Outer shell | |
| Low resolution limit [Å] | 42.735 | 1.090 | |
| High resolution limit [Å] | 1.030 | 3.080 | 1.030 |
| Rmerge | 0.032 | 0.018 | 0.402 |
| Rmeas | 0.038 | 0.021 | 0.490 |
| Total number of observations | 546958 | ||
| Number of reflections | 153940 | 6046 | 20160 |
| <I/σ(I)> | 18.17 | 65.76 | 2.36 |
| Completeness [%] | 96.3 | 99.2 | 78.3 |
| Redundancy | 3.553 | ||
| CC(1/2) | 1.000 | 0.999 | 0.806 |
Crystallization Conditions
| crystal ID | method | pH | temperature | details |
| 1 | VAPOR DIFFUSION, SITTING DROP | 4.6 | 290 | 0.1 M ammonium acetate, 0.1 M sodium acetate, 24-30% PEG 4000; crystal obtained by streak-seeding and soaked with 90 mM of fragment 304 with the SMILES code COC1=CC(=CC=C1)C1=NN2C(NC(C)=CC2=O)=C1 |






