5P71
Automated refinement of diffraction data obtained from an endothiapepsin crystal treated with fragment 298
Experimental procedure
| Experimental method | SINGLE WAVELENGTH |
| Source type | SYNCHROTRON |
| Source details | BESSY BEAMLINE 14.1 |
| Synchrotron site | BESSY |
| Beamline | 14.1 |
| Temperature [K] | 100 |
| Detector technology | PIXEL |
| Collection date | 2013-07-18 |
| Detector | DECTRIS PILATUS 6M |
| Wavelength(s) | 0.918409 |
| Spacegroup name | P 1 21 1 |
| Unit cell lengths | 45.322, 73.210, 52.702 |
| Unit cell angles | 90.00, 109.52, 90.00 |
Refinement procedure
| Resolution | 42.718 - 1.030 |
| R-factor | 0.1226 |
| Rwork | 0.122 |
| R-free | 0.13230 |
| Structure solution method | MOLECULAR REPLACEMENT |
| Starting model (for MR) | 4y5l |
| RMSD bond length | 0.006 |
| RMSD bond angle | 1.207 |
| Data reduction software | XDS |
| Data scaling software | XDS |
| Phasing software | PHASER (2.5.7) |
| Refinement software | PHENIX |
Data quality characteristics
| Overall | Inner shell | Outer shell | |
| Low resolution limit [Å] | 42.718 | 1.090 | |
| High resolution limit [Å] | 1.030 | 3.080 | 1.030 |
| Rmerge | 0.036 | 0.023 | 0.444 |
| Rmeas | 0.042 | 0.027 | 0.539 |
| Total number of observations | 545500 | ||
| Number of reflections | 150905 | 6038 | 19730 |
| <I/σ(I)> | 16.78 | 52.99 | 2.16 |
| Completeness [%] | 94.3 | 99 | 76.5 |
| Redundancy | 3.614 | ||
| CC(1/2) | 0.999 | 0.999 | 0.765 |
Crystallization Conditions
| crystal ID | method | pH | temperature | details |
| 1 | VAPOR DIFFUSION, SITTING DROP | 4.6 | 290 | 0.1 M ammonium acetate, 0.1 M sodium acetate, 24-30% PEG 4000; crystal obtained by streak-seeding and soaked with 90 mM of fragment 298 with the SMILES code CC(C)(C)OC(=O)N1[C@H]2CC[C@@H]1C(=O)CCC2 |






