5P6J
Automated refinement of diffraction data obtained from an endothiapepsin crystal treated with fragment 280
Experimental procedure
| Experimental method | SINGLE WAVELENGTH |
| Source type | SYNCHROTRON |
| Source details | BESSY BEAMLINE 14.1 |
| Synchrotron site | BESSY |
| Beamline | 14.1 |
| Temperature [K] | 100 |
| Detector technology | PIXEL |
| Collection date | 2013-07-18 |
| Detector | DECTRIS PILATUS 6M |
| Wavelength(s) | 0.918409 |
| Spacegroup name | P 1 21 1 |
| Unit cell lengths | 45.243, 73.184, 52.797 |
| Unit cell angles | 90.00, 109.43, 90.00 |
Refinement procedure
| Resolution | 39.543 - 1.259 |
| R-factor | 0.129 |
| Rwork | 0.128 |
| R-free | 0.14420 |
| Structure solution method | MOLECULAR REPLACEMENT |
| Starting model (for MR) | 4y5l |
| RMSD bond length | 0.007 |
| RMSD bond angle | 1.184 |
| Data reduction software | XDS |
| Data scaling software | XDS |
| Phasing software | PHASER (2.5.7) |
| Refinement software | PHENIX |
Data quality characteristics
| Overall | Inner shell | Outer shell | |
| Low resolution limit [Å] | 42.667 | 1.340 | |
| High resolution limit [Å] | 1.260 | 3.770 | 1.260 |
| Rmerge | 0.045 | 0.017 | 0.517 |
| Rmeas | 0.053 | 0.020 | 0.603 |
| Total number of observations | 324079 | ||
| Number of reflections | 87198 | 3333 | 13948 |
| <I/σ(I)> | 17.09 | 63.33 | 2.4 |
| Completeness [%] | 99.5 | 99.4 | 98.8 |
| Redundancy | 3.716 | ||
| CC(1/2) | 0.999 | 0.999 | 0.769 |
Crystallization Conditions
| crystal ID | method | pH | temperature | details |
| 1 | VAPOR DIFFUSION, SITTING DROP | 4.6 | 290 | 0.1 M ammonium acetate, 0.1 M sodium acetate, 24-30% PEG 4000; crystal obtained by streak-seeding and soaked with 90 mM of fragment 280 with the SMILES code OC(=O)\C=C\C1=C(F)C=CC=C1F |






