5P4F
Automated refinement of diffraction data obtained from an endothiapepsin crystal treated with fragment 204
Experimental procedure
| Experimental method | SINGLE WAVELENGTH |
| Source type | SYNCHROTRON |
| Source details | BESSY BEAMLINE 14.3 |
| Synchrotron site | BESSY |
| Beamline | 14.3 |
| Temperature [K] | 100 |
| Detector technology | CCD |
| Collection date | 2013-04-18 |
| Detector | MAR CCD 165 mm |
| Wavelength(s) | 0.8944 |
| Spacegroup name | P 1 21 1 |
| Unit cell lengths | 45.265, 72.935, 52.649 |
| Unit cell angles | 90.00, 109.32, 90.00 |
Refinement procedure
| Resolution | 29.399 - 1.409 |
| R-factor | 0.1348 |
| Rwork | 0.133 |
| R-free | 0.16230 |
| Structure solution method | MOLECULAR REPLACEMENT |
| Starting model (for MR) | 4y5l |
| RMSD bond length | 0.007 |
| RMSD bond angle | 1.166 |
| Data reduction software | XDS |
| Data scaling software | XDS |
| Phasing software | PHASER (2.5.7) |
| Refinement software | PHENIX |
Data quality characteristics
| Overall | Inner shell | Outer shell | |
| Low resolution limit [Å] | 42.717 | 1.490 | |
| High resolution limit [Å] | 1.410 | 4.210 | 1.410 |
| Rmerge | 0.075 | 0.027 | 0.501 |
| Rmeas | 0.087 | 0.031 | 0.580 |
| Total number of observations | 247057 | ||
| Number of reflections | 62097 | 2390 | 9893 |
| <I/σ(I)> | 16.49 | 46.06 | 3.61 |
| Completeness [%] | 99.6 | 98.9 | 98.7 |
| Redundancy | 3.978 | ||
| CC(1/2) | 0.998 | 0.999 | 0.835 |
Crystallization Conditions
| crystal ID | method | pH | temperature | details |
| 1 | VAPOR DIFFUSION, SITTING DROP | 4.6 | 290 | 0.1 M ammonium acetate, 0.1 M sodium acetate, 24-30% PEG 4000; crystal obtained by streak-seeding and soaked with 90 mM of fragment 204 with the SMILES code CS(=O)(=O)C1=C2C=CCCC2=C(S1)C(N)=O |






