5P3R
Automated refinement of diffraction data obtained from an endothiapepsin crystal treated with fragment 180
Experimental procedure
| Experimental method | SINGLE WAVELENGTH |
| Source type | SYNCHROTRON |
| Source details | BESSY BEAMLINE 14.1 |
| Synchrotron site | BESSY |
| Beamline | 14.1 |
| Temperature [K] | 100 |
| Detector technology | PIXEL |
| Collection date | 2013-04-04 |
| Detector | DECTRIS PILATUS 6M |
| Wavelength(s) | 0.918409 |
| Spacegroup name | P 21 21 21 |
| Unit cell lengths | 45.130, 72.514, 103.775 |
| Unit cell angles | 90.00, 90.00, 90.00 |
Refinement procedure
| Resolution | 42.197 - 1.369 |
| R-factor | 0.1377 |
| Rwork | 0.136 |
| R-free | 0.16270 |
| Structure solution method | MOLECULAR REPLACEMENT |
| Starting model (for MR) | 4y5l |
| RMSD bond length | 0.007 |
| RMSD bond angle | 1.179 |
| Data reduction software | XDS |
| Data scaling software | XDS |
| Phasing software | PHASER (2.5.7) |
| Refinement software | PHENIX |
Data quality characteristics
| Overall | Inner shell | Outer shell | |
| Low resolution limit [Å] | 45.130 | 1.450 | |
| High resolution limit [Å] | 1.370 | 4.090 | 1.370 |
| Rmerge | 0.053 | 0.022 | 0.480 |
| Rmeas | 0.057 | 0.024 | 0.519 |
| Total number of observations | 497564 | ||
| Number of reflections | 70996 | 2925 | 11147 |
| <I/σ(I)> | 21.14 | 64.3 | 3.76 |
| Completeness [%] | 97.9 | 99.6 | 96.5 |
| Redundancy | 7.008 | ||
| CC(1/2) | 1.000 | 0.999 | 0.896 |
Crystallization Conditions
| crystal ID | method | pH | temperature | details |
| 1 | VAPOR DIFFUSION, SITTING DROP | 4.6 | 290 | 0.1 M ammonium acetate, 0.1 M sodium acetate, 24-30% PEG 4000; crystal obtained by streak-seeding and soaked with 90 mM of fragment 180 with the SMILES code CC(C)C1=CSC(NC(=O)CN2CCSC2=O)=N1 |






