5P36
Automated refinement of diffraction data obtained from an endothiapepsin crystal treated with fragment 159
Experimental procedure
| Experimental method | SINGLE WAVELENGTH |
| Source type | SYNCHROTRON |
| Source details | BESSY BEAMLINE 14.3 |
| Synchrotron site | BESSY |
| Beamline | 14.3 |
| Temperature [K] | 100 |
| Detector technology | CCD |
| Collection date | 2013-04-12 |
| Detector | MAR CCD 165 mm |
| Wavelength(s) | 0.8944 |
| Spacegroup name | P 1 21 1 |
| Unit cell lengths | 45.232, 72.925, 52.613 |
| Unit cell angles | 90.00, 109.35, 90.00 |
Refinement procedure
| Resolution | 34.708 - 1.369 |
| R-factor | 0.1519 |
| Rwork | 0.150 |
| R-free | 0.18320 |
| Structure solution method | MOLECULAR REPLACEMENT |
| Starting model (for MR) | 4y5l |
| RMSD bond length | 0.008 |
| RMSD bond angle | 1.169 |
| Data reduction software | XDS |
| Data scaling software | XDS |
| Phasing software | PHASER (2.5.7) |
| Refinement software | PHENIX |
Data quality characteristics
| Overall | Inner shell | Outer shell | |
| Low resolution limit [Å] | 42.678 | 1.450 | |
| High resolution limit [Å] | 1.370 | 4.090 | 1.370 |
| Rmerge | 0.060 | 0.019 | 0.477 |
| Rmeas | 0.070 | 0.022 | 0.550 |
| Total number of observations | 257644 | ||
| Number of reflections | 66262 | 2498 | 10503 |
| <I/σ(I)> | 16.26 | 50.64 | 2.91 |
| Completeness [%] | 97.6 | 95.8 | 95.8 |
| Redundancy | 3.888 | ||
| CC(1/2) | 0.999 | 0.999 | 0.790 |
Crystallization Conditions
| crystal ID | method | pH | temperature | details |
| 1 | VAPOR DIFFUSION, SITTING DROP | 4.6 | 290 | 0.1 M ammonium acetate, 0.1 M sodium acetate, 24-30% PEG 4000; crystal obtained by streak-seeding and soaked with 90 mM of fragment 159 with the SMILES code C[C@H](N1CCCCCC1)C(=O)C1=CNC2=CC=CC=C12 |






