5P08
Automated refinement of diffraction data obtained from an endothiapepsin crystal treated with fragment 55
Experimental procedure
| Experimental method | SINGLE WAVELENGTH |
| Source type | SYNCHROTRON |
| Source details | BESSY BEAMLINE 14.1 |
| Synchrotron site | BESSY |
| Beamline | 14.1 |
| Temperature [K] | 100 |
| Detector technology | CCD |
| Collection date | 2012-11-16 |
| Detector | MARMOSAIC 225 mm CCD |
| Wavelength(s) | 0.8912 |
| Spacegroup name | P 1 21 1 |
| Unit cell lengths | 45.105, 72.960, 52.486 |
| Unit cell angles | 90.00, 109.43, 90.00 |
Refinement procedure
| Resolution | 39.378 - 1.605 |
| R-factor | 0.1476 |
| Rwork | 0.145 |
| R-free | 0.19050 |
| Structure solution method | MOLECULAR REPLACEMENT |
| Starting model (for MR) | 4y5l |
| RMSD bond length | 0.008 |
| RMSD bond angle | 1.171 |
| Data reduction software | XDS |
| Data scaling software | XDS |
| Phasing software | PHASER (2.5.7) |
| Refinement software | PHENIX |
Data quality characteristics
| Overall | Inner shell | Outer shell | |
| Low resolution limit [Å] | 42.538 | 1.700 | |
| High resolution limit [Å] | 1.600 | 4.790 | 1.600 |
| Rmerge | 0.064 | 0.022 | 0.431 |
| Rmeas | 0.073 | 0.025 | 0.507 |
| Total number of observations | 166438 | ||
| Number of reflections | 40237 | 1594 | 5528 |
| <I/σ(I)> | 18.51 | 50.83 | 3.38 |
| Completeness [%] | 95.7 | 97.3 | 82 |
| Redundancy | 4.136 | ||
| CC(1/2) | 0.998 | 0.999 | 0.816 |
Crystallization Conditions
| crystal ID | method | pH | temperature | details |
| 1 | VAPOR DIFFUSION, SITTING DROP | 4.6 | 290 | 0.1 M ammonium acetate, 0.1 M sodium acetate, 24-30% PEG 4000; crystal obtained by streak-seeding and soaked with 90 mM of fragment 55 with the SMILES code COC(=O)C1=CC=C(Cl)C=C1NC(C)=O |






