5OZS
Automated refinement of diffraction data obtained from an endothiapepsin crystal treated with fragment 39
Experimental procedure
| Experimental method | SINGLE WAVELENGTH |
| Source type | SYNCHROTRON |
| Source details | BESSY BEAMLINE 14.1 |
| Synchrotron site | BESSY |
| Beamline | 14.1 |
| Temperature [K] | 100 |
| Detector technology | CCD |
| Collection date | 2012-09-04 |
| Detector | MARMOSAIC 225 mm CCD |
| Wavelength(s) | 0.91841 |
| Spacegroup name | P 1 21 1 |
| Unit cell lengths | 45.408, 73.304, 53.044 |
| Unit cell angles | 90.00, 109.74, 90.00 |
Refinement procedure
| Resolution | 34.960 - 1.720 |
| R-factor | 0.1453 |
| Rwork | 0.142 |
| R-free | 0.19830 |
| Structure solution method | MOLECULAR REPLACEMENT |
| Starting model (for MR) | 4y5l |
| RMSD bond length | 0.009 |
| RMSD bond angle | 1.128 |
| Data reduction software | HKL-2000 |
| Data scaling software | XDS |
| Phasing software | PHASER (2.5.7) |
| Refinement software | PHENIX |
Data quality characteristics
| Overall | Inner shell | Outer shell | |
| Low resolution limit [Å] | 50.000 | 50.000 | 1.750 |
| High resolution limit [Å] | 1.720 | 4.670 | 1.720 |
| Rmerge | 0.064 | 0.021 | 0.536 |
| Total number of observations | 145561 | ||
| Number of reflections | 34769 | ||
| <I/σ(I)> | 10.2 | ||
| Completeness [%] | 99.9 | 99.6 | 99.9 |
| Redundancy | 4.2 | 4.1 | 4.2 |
Crystallization Conditions
| crystal ID | method | pH | temperature | details |
| 1 | VAPOR DIFFUSION, SITTING DROP | 4.6 | 290 | 0.1 M ammonium acetate, 0.1 M sodium acetate, 24-30% PEG 4000; crystal obtained by streak-seeding and soaked with 90 mM of fragment 39 with the SMILES code C(NC1CCCC1)C1=CC=C2OCOC2=C1 |






