XLF

?

Summary

Name:beta-D-xylulofuranose
Synonyms:beta-D-xylulose
D-xylulose; xylulose
Formula:C5 H10 O5
Formal charge:0
Molecular weight:150.13 Da
Component type:D-saccharide, beta linking

Chemical Identifiers

ProgramVersionName
ACDLabs10.04beta-D-xylulofuranose
OpenEye OEToolkits1.5.0(2R,3S,4R)-2-(hydroxymethyl)oxolane-2,3,4-triol
GMML1.0DXulfb
GMML1.0b-D-xylulofuranose
PDB-CARE1.0b-D-Xulf

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04OCC1(O)OCC(O)C1O
SMILES_CANONICALCACTVS3.341OC[C@@]1(O)OC[C@@H](O)[C@@H]1O
SMILESCACTVS3.341OC[C]1(O)OC[CH](O)[CH]1O
SMILES_CANONICALOpenEye OEToolkits1.5.0C1[C@H]([C@@H]([C@](O1)(CO)O)O)O
SMILESOpenEye OEToolkits1.5.0C1C(C(C(O1)(CO)O)O)O
InChIInChI1.03InChI=1S/C5H10O5/c6-2-5(9)4(8)3(7)1-10-5/h3-4,6-9H,1-2H2/t3-,4+,5-/m1/s1
InChIKeyInChI1.03LQXVFWRQNMEDEE-MROZADKFSA-N
170172
PDB entries from 2020-10-21