V55

?

Summary

Name:4-hydroxy-3-methoxybenzaldehyde
Formula:C8 H8 O3
Formal charge:0
Molecular weight:152.147 Da
Component type:non-polymer

Chemical Identifiers

ProgramVersionName
ACDLabs10.044-hydroxy-3-methoxybenzaldehyde
OpenEye OEToolkits1.5.04-hydroxy-3-methoxy-benzaldehyde

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04O=Cc1cc(OC)c(O)cc1
SMILES_CANONICALCACTVS3.341COc1cc(C=O)ccc1O
SMILESCACTVS3.341COc1cc(C=O)ccc1O
SMILES_CANONICALOpenEye OEToolkits1.5.0COc1cc(ccc1O)C=O
SMILESOpenEye OEToolkits1.5.0COc1cc(ccc1O)C=O
InChIInChI1.03InChI=1S/C8H8O3/c1-11-8-4-6(5-9)2-3-7(8)10/h2-5,10H,1H3
InChIKeyInChI1.03MWOOGOJBHIARFG-UHFFFAOYSA-N