TE4

?

Summary

Name:Tetracaine
Synonyms:2-(dimethylamino)ethyl 4-(butylamino)benzoate
Formula:C15 H24 N2 O2
Formal charge:0
Molecular weight:264.363 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs12.012-(dimethylamino)ethyl 4-(butylamino)benzoate
OpenEye OEToolkits1.7.62-(dimethylamino)ethyl 4-(butylamino)benzoate

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01O=C(OCCN(C)C)c1ccc(NCCCC)cc1
InChIInChI1.03InChI=1S/C15H24N2O2/c1-4-5-10-16-14-8-6-13(7-9-14)15(18)19-12-11-17(2)3/h6-9,16H,4-5,10-12H2,1-3H3
InChIKeyInChI1.03GKCBAIGFKIBETG-UHFFFAOYSA-N
SMILES_CANONICALCACTVS3.385CCCCNc1ccc(cc1)C(=O)OCCN(C)C
SMILESCACTVS3.385CCCCNc1ccc(cc1)C(=O)OCCN(C)C
SMILES_CANONICALOpenEye OEToolkits1.7.6CCCCNc1ccc(cc1)C(=O)OCCN(C)C
SMILESOpenEye OEToolkits1.7.6CCCCNc1ccc(cc1)C(=O)OCCN(C)C