PCR

?

Summary

Name:P-CRESOL
Formula:C7 H8 O
Formal charge:0
Molecular weight:108.138 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs10.044-methylphenol
OpenEye OEToolkits1.5.04-methylphenol

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04Oc1ccc(cc1)C
SMILES_CANONICALCACTVS3.341Cc1ccc(O)cc1
SMILESCACTVS3.341Cc1ccc(O)cc1
SMILES_CANONICALOpenEye OEToolkits1.5.0Cc1ccc(cc1)O
SMILESOpenEye OEToolkits1.5.0Cc1ccc(cc1)O
InChIInChI1.03InChI=1S/C7H8O/c1-6-2-4-7(8)5-3-6/h2-5,8H,1H3
InChIKeyInChI1.03IWDCLRJOBJJRNH-UHFFFAOYSA-N