PAM

?

Summary

Name:PALMITOLEIC ACID
Formula:C16 H30 O2
Formal charge:0
Molecular weight:254.408 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs10.04(9Z)-hexadec-9-enoic acid
OpenEye OEToolkits1.5.0(Z)-hexadec-9-enoic acid

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04O=C(O)CCCCCCC\C=C/CCCCCC
SMILES_CANONICALCACTVS3.341CCCCCC\C=C/CCCCCCCC(O)=O
SMILESCACTVS3.341CCCCCCC=CCCCCCCCC(O)=O
SMILES_CANONICALOpenEye OEToolkits1.5.0CCCCCC\C=C/CCCCCCCC(=O)O
SMILESOpenEye OEToolkits1.5.0CCCCCCC=CCCCCCCCC(=O)O
InChIInChI1.03InChI=1S/C16H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h7-8H,2-6,9-15H2,1H3,(H,17,18)/b8-7-
InChIKeyInChI1.03SECPZKHBENQXJG-FPLPWBNLSA-N