OLN

?

Summary

Name:(S)-2-ACETAMIDO-5-UREIDOPENTANOIC ACID
Synonyms:N-ACETYL-L-CITRULLINE
Formula:C8 H15 N3 O4
Formal charge:0
Molecular weight:217.222 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs10.04N~2~-acetyl-N~5~-carbamoyl-L-ornithine
OpenEye OEToolkits1.5.0(2S)-2-acetamido-5-(aminocarbonylamino)pentanoic acid

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04O=C(O)C(NC(=O)C)CCCNC(=O)N
SMILES_CANONICALCACTVS3.341CC(=O)N[C@@H](CCCNC(N)=O)C(O)=O
SMILESCACTVS3.341CC(=O)N[CH](CCCNC(N)=O)C(O)=O
SMILES_CANONICALOpenEye OEToolkits1.5.0CC(=O)N[C@@H](CCCNC(=O)N)C(=O)O
SMILESOpenEye OEToolkits1.5.0CC(=O)NC(CCCNC(=O)N)C(=O)O
InChIInChI1.03InChI=1S/C8H15N3O4/c1-5(12)11-6(7(13)14)3-2-4-10-8(9)15/h6H,2-4H2,1H3,(H,11,12)(H,13,14)(H3,9,10,15)/t6-/m0/s1
InChIKeyInChI1.03WMQMIOYQXNRROC-LURJTMIESA-N
167518
PDB entries from 2020-08-12