MIG

?

Summary

Name:(2R,3R,4R,5S)-1-(2-hydroxyethyl)-2-(hydroxymethyl)piperidine-3,4,5-triol
Synonyms:Miglitol
Formula:C8 H17 N O5
Formal charge:0
Molecular weight:207.224 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
OpenEye OEToolkits1.6.1(1R,2R,3R,4R,5S)-1-(2-hydroxyethyl)-2-(hydroxymethyl)piperidine-3,4,5-triol

Chemical Descriptors

TypeProgramVersionDescriptor
SMILES_CANONICALCACTVS3.352OCCN1C[C@H](O)[C@@H](O)[C@H](O)[C@H]1CO
SMILESCACTVS3.352OCCN1C[CH](O)[CH](O)[CH](O)[CH]1CO
SMILES_CANONICALOpenEye OEToolkits1.7.0C1[C@@H]([C@H]([C@@H]([C@H]([N@@]1CCO)CO)O)O)O
SMILESOpenEye OEToolkits1.7.0C1C(C(C(C(N1CCO)CO)O)O)O
InChIInChI1.03InChI=1S/C8H17NO5/c10-2-1-9-3-6(12)8(14)7(13)5(9)4-11/h5-8,10-14H,1-4H2/t5-,6+,7-,8-/m1/s1
InChIKeyInChI1.03IBAQFPQHRJAVAV-ULAWRXDQSA-N
167518
PDB entries from 2020-08-12