MCH

?

Summary

Name:trichloromethane
Synonyms:Chloroform CHCl3
Formula:C H Cl3
Formal charge:0
Molecular weight:119.378 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs10.04trichloromethane
OpenEye OEToolkits1.5.0trichloromethane

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04ClC(Cl)Cl
SMILES_CANONICALCACTVS3.341ClC(Cl)Cl
SMILESCACTVS3.341ClC(Cl)Cl
SMILES_CANONICALOpenEye OEToolkits1.5.0C(Cl)(Cl)Cl
SMILESOpenEye OEToolkits1.5.0C(Cl)(Cl)Cl
InChIInChI1.03InChI=1S/CHCl3/c2-1(3)4/h1H
InChIKeyInChI1.03HEDRZPFGACZZDS-UHFFFAOYSA-N
171313
PDB entries from 2020-11-18