GRQ

?

Summary

Name:Geranaldehyde
Formula:C10 H16 O
Formal charge:0
Molecular weight:152.233 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
OpenEye OEToolkits2.0.6(2~{E})-3,7-dimethylocta-2,6-dienal

Chemical Descriptors

TypeProgramVersionDescriptor
InChIInChI1.03InChI=1S/C10H16O/c1-9(2)5-4-6-10(3)7-8-11/h5,7-8H,4,6H2,1-3H3/b10-7+
InChIKeyInChI1.03WTEVQBCEXWBHNA-JXMROGBWSA-N
SMILES_CANONICALCACTVS3.385CC(C)=CCC/C(C)=C/C=O
SMILESCACTVS3.385CC(C)=CCCC(C)=CC=O
SMILES_CANONICALOpenEye OEToolkits2.0.6CC(=CCC/C(=C/C=O)/C)C
SMILESOpenEye OEToolkits2.0.6CC(=CCCC(=CC=O)C)C