GLV

?

Summary

Name:GLYOXYLIC ACID
Synonyms:GLYOXALATE, GLYOXYLATE
Formula:C2 H2 O3
Formal charge:0
Molecular weight:74.035 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs10.04oxoacetic acid
OpenEye OEToolkits1.5.0oxaldehydic acid

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04O=CC(=O)O
SMILES_CANONICALCACTVS3.341OC(=O)C=O
SMILESCACTVS3.341OC(=O)C=O
SMILES_CANONICALOpenEye OEToolkits1.5.0C(=O)C(=O)O
SMILESOpenEye OEToolkits1.5.0C(=O)C(=O)O
InChIInChI1.03InChI=1S/C2H2O3/c3-1-2(4)5/h1H,(H,4,5)
InChIKeyInChI1.03HHLFWLYXYJOTON-UHFFFAOYSA-N