FVT

?

Summary

Name:5-azanyl-4-oxidanylidene-pentanoic acid
Formula:C5 H9 N O3
Formal charge:0
Molecular weight:131.13 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
OpenEye OEToolkits2.0.65-azanyl-4-oxidanylidene-pentanoic acid

Chemical Descriptors

TypeProgramVersionDescriptor
InChIInChI1.03InChI=1S/C5H9NO3/c6-3-4(7)1-2-5(8)9/h1-3,6H2,(H,8,9)
InChIKeyInChI1.03ZGXJTSGNIOSYLO-UHFFFAOYSA-N
SMILES_CANONICALCACTVS3.385NCC(=O)CCC(O)=O
SMILESCACTVS3.385NCC(=O)CCC(O)=O
SMILES_CANONICALOpenEye OEToolkits2.0.6C(CC(=O)O)C(=O)CN
SMILESOpenEye OEToolkits2.0.6C(CC(=O)O)C(=O)CN
169963
PDB entries from 2020-10-14