FUC

?

Summary

Name:ALPHA-L-FUCOSE
Formula:C6 H12 O5
Formal charge:0
Molecular weight:164.156 Da
Component type:SACCHARIDE

Chemical Identifiers

ProgramVersionName
ACDLabs10.046-deoxy-alpha-L-galactopyranose
OpenEye OEToolkits1.5.0(2R,3S,4R,5S,6S)-6-methyloxane-2,3,4,5-tetrol

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04OC1C(O)C(OC(O)C1O)C
SMILES_CANONICALCACTVS3.341C[C@@H]1O[C@@H](O)[C@@H](O)[C@H](O)[C@@H]1O
SMILESCACTVS3.341C[CH]1O[CH](O)[CH](O)[CH](O)[CH]1O
SMILES_CANONICALOpenEye OEToolkits1.5.0C[C@H]1[C@H]([C@H]([C@@H]([C@@H](O1)O)O)O)O
SMILESOpenEye OEToolkits1.5.0CC1C(C(C(C(O1)O)O)O)O
InChIInChI1.03InChI=1S/C6H12O5/c1-2-3(7)4(8)5(9)6(10)11-2/h2-10H,1H3/t2-,3+,4+,5-,6+/m0/s1
InChIKeyInChI1.03SHZGCJCMOBCMKK-SXUWKVJYSA-N