F3V

?

Summary

Name:1-aminopropan-2-one
Formula:C3 H7 N O
Formal charge:0
Molecular weight:73.094 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs12.011-aminopropan-2-one
OpenEye OEToolkits2.0.61-azanylpropan-2-one

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01NCC(=O)C
InChIInChI1.03InChI=1S/C3H7NO/c1-3(5)2-4/h2,4H2,1H3
InChIKeyInChI1.03BCDGQXUMWHRQCB-UHFFFAOYSA-N
SMILES_CANONICALCACTVS3.385CC(=O)CN
SMILESCACTVS3.385CC(=O)CN
SMILES_CANONICALOpenEye OEToolkits2.0.6CC(=O)CN
SMILESOpenEye OEToolkits2.0.6CC(=O)CN
169117
PDB entries from 2020-09-23