F0J

?

Summary

Name:2,4-dimethoxyphenol
Formula:C8 H10 O3
Formal charge:0
Molecular weight:154.163 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs12.012,4-dimethoxyphenol
OpenEye OEToolkits2.0.62,4-dimethoxyphenol

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01COc1ccc(c(OC)c1)O
InChIInChI1.03InChI=1S/C8H10O3/c1-10-6-3-4-7(9)8(5-6)11-2/h3-5,9H,1-2H3
InChIKeyInChI1.03MNVMYTVDDOXZLS-UHFFFAOYSA-N
SMILES_CANONICALCACTVS3.385COc1ccc(O)c(OC)c1
SMILESCACTVS3.385COc1ccc(O)c(OC)c1
SMILES_CANONICALOpenEye OEToolkits2.0.6COc1ccc(c(c1)OC)O
SMILESOpenEye OEToolkits2.0.6COc1ccc(c(c1)OC)O