ES1

?

Summary

Name:quinolin-4-ol
Formula:C9 H7 N O
Formal charge:0
Molecular weight:145.158 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
OpenEye OEToolkits1.6.1quinolin-4-ol

Chemical Descriptors

TypeProgramVersionDescriptor
SMILES_CANONICALCACTVS3.352Oc1ccnc2ccccc12
SMILESCACTVS3.352Oc1ccnc2ccccc12
SMILES_CANONICALOpenEye OEToolkits1.7.0c1ccc2c(c1)c(ccn2)O
SMILESOpenEye OEToolkits1.7.0c1ccc2c(c1)c(ccn2)O
InChIInChI1.03InChI=1S/C9H7NO/c11-9-5-6-10-8-4-2-1-3-7(8)9/h1-6H,(H,10,11)
InChIKeyInChI1.03PMZDQRJGMBOQBF-UHFFFAOYSA-N
168889
PDB entries from 2020-09-16