DUB

?

Summary

Name:2,6-dichlorophenol
Formula:C6 H4 Cl2 O
Formal charge:0
Molecular weight:163.001 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
OpenEye OEToolkits2.0.62,6-bis(chloranyl)phenol

Chemical Descriptors

TypeProgramVersionDescriptor
InChIInChI1.03InChI=1S/C6H4Cl2O/c7-4-2-1-3-5(8)6(4)9/h1-3,9H
InChIKeyInChI1.03HOLHYSJJBXSLMV-UHFFFAOYSA-N
SMILES_CANONICALCACTVS3.385Oc1c(Cl)cccc1Cl
SMILESCACTVS3.385Oc1c(Cl)cccc1Cl
SMILES_CANONICALOpenEye OEToolkits2.0.6c1cc(c(c(c1)Cl)O)Cl
SMILESOpenEye OEToolkits2.0.6c1cc(c(c(c1)Cl)O)Cl
171916
PDB entries from 2020-12-02