DHY

?

Summary

Name:2-(3,4-DIHYDROXYPHENYL)ACETIC ACID
Formula:C8 H8 O4
Formal charge:0
Molecular weight:168.147 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs10.04(3,4-dihydroxyphenyl)acetic acid
OpenEye OEToolkits1.5.02-(3,4-dihydroxyphenyl)ethanoic acid

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04O=C(O)Cc1cc(O)c(O)cc1
SMILES_CANONICALCACTVS3.341OC(=O)Cc1ccc(O)c(O)c1
SMILESCACTVS3.341OC(=O)Cc1ccc(O)c(O)c1
SMILES_CANONICALOpenEye OEToolkits1.5.0c1cc(c(cc1CC(=O)O)O)O
SMILESOpenEye OEToolkits1.5.0c1cc(c(cc1CC(=O)O)O)O
InChIInChI1.03InChI=1S/C8H8O4/c9-6-2-1-5(3-7(6)10)4-8(11)12/h1-3,9-10H,4H2,(H,11,12)
InChIKeyInChI1.03CFFZDZCDUFSOFZ-UHFFFAOYSA-N
167132
PDB entries from 2020-07-29