DHB

?

Summary

Name:3,4-DIHYDROXYBENZOIC ACID
Formula:C7 H6 O4
Formal charge:0
Molecular weight:154.12 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs10.043,4-dihydroxybenzoic acid
OpenEye OEToolkits1.5.03,4-dihydroxybenzoic acid

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04O=C(O)c1cc(O)c(O)cc1
SMILES_CANONICALCACTVS3.341OC(=O)c1ccc(O)c(O)c1
SMILESCACTVS3.341OC(=O)c1ccc(O)c(O)c1
SMILES_CANONICALOpenEye OEToolkits1.5.0c1cc(c(cc1C(=O)O)O)O
SMILESOpenEye OEToolkits1.5.0c1cc(c(cc1C(=O)O)O)O
InChIInChI1.03InChI=1S/C7H6O4/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3,8-9H,(H,10,11)
InChIKeyInChI1.03YQUVCSBJEUQKSH-UHFFFAOYSA-N