DGY

?

Summary

Name:(2R)-2,3-DIHYDROXYPROPANOIC ACID
Formula:C3 H6 O4
Formal charge:0
Molecular weight:106.077 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs10.04(2R)-2,3-dihydroxypropanoic acid
OpenEye OEToolkits1.5.0(2R)-2,3-dihydroxypropanoic acid

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04O=C(O)C(O)CO
SMILES_CANONICALCACTVS3.341OC[C@@H](O)C(O)=O
SMILESCACTVS3.341OC[CH](O)C(O)=O
SMILES_CANONICALOpenEye OEToolkits1.5.0C([C@H](C(=O)O)O)O
SMILESOpenEye OEToolkits1.5.0C(C(C(=O)O)O)O
InChIInChI1.03InChI=1S/C3H6O4/c4-1-2(5)3(6)7/h2,4-5H,1H2,(H,6,7)/t2-/m1/s1
InChIKeyInChI1.03RBNPOMFGQQGHHO-UWTATZPHSA-N