DCD

?

Summary

Name:DIETHYLCARBAMODITHIOIC ACID
Formula:C5 H11 N S2
Formal charge:0
Molecular weight:149.278 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs10.04diethylcarbamodithioic acid
OpenEye OEToolkits1.5.0diethylaminomethanedithioic acid

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04S=C(S)N(CC)CC
SMILES_CANONICALCACTVS3.341CCN(CC)C(S)=S
SMILESCACTVS3.341CCN(CC)C(S)=S
SMILES_CANONICALOpenEye OEToolkits1.5.0CCN(CC)C(=S)S
SMILESOpenEye OEToolkits1.5.0CCN(CC)C(=S)S
InChIInChI1.03InChI=1S/C5H11NS2/c1-3-6(4-2)5(7)8/h3-4H2,1-2H3,(H,7,8)
InChIKeyInChI1.03LMBWSYZSUOEYSN-UHFFFAOYSA-N
167518
PDB entries from 2020-08-12