DAL

?

Summary

Name:D-ALANINE
Formula:C3 H7 N O2
Formal charge:0
Molecular weight:89.093 Da
Component type:D-PEPTIDE LINKING

Chemical Identifiers

ProgramVersionName
ACDLabs10.04D-alanine
OpenEye OEToolkits1.5.0(2R)-2-aminopropanoic acid

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04O=C(O)C(N)C
SMILES_CANONICALCACTVS3.341C[C@@H](N)C(O)=O
SMILESCACTVS3.341C[CH](N)C(O)=O
SMILES_CANONICALOpenEye OEToolkits1.5.0C[C@H](C(=O)O)N
SMILESOpenEye OEToolkits1.5.0CC(C(=O)O)N
InChIInChI1.03InChI=1S/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6)/t2-/m1/s1
InChIKeyInChI1.03QNAYBMKLOCPYGJ-UWTATZPHSA-N
169963
PDB entries from 2020-10-14