CBU

?

Summary

Name:(1R,2R,3S,4S,5S,6S)-CYCLOHEXANE-1,2,3,4,5,6-HEXOL
Formula:C6 H12 O6
Formal charge:0
Molecular weight:180.156 Da
Component type:non-polymer

Chemical Identifiers

ProgramVersionName
ACDLabs10.04(1R,2R,3S,4S,5S,6S)-cyclohexane-1,2,3,4,5,6-hexol
OpenEye OEToolkits1.5.0cyclohexane-1,2,3,4,5,6-hexol

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04OC1C(O)C(O)C(O)C(O)C1O
SMILES_CANONICALCACTVS3.341O[C@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)[C@@H]1O
SMILESCACTVS3.341O[CH]1[CH](O)[CH](O)[CH](O)[CH](O)[CH]1O
SMILES_CANONICALOpenEye OEToolkits1.5.0C1(C(C(C(C(C1O)O)O)O)O)O
SMILESOpenEye OEToolkits1.5.0C1(C(C(C(C(C1O)O)O)O)O)O
InChIInChI1.03InChI=1S/C6H12O6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-12H/t1-,2-,3-,4-,5+,6+/m0/s1
InChIKeyInChI1.03CDAISMWEOUEBRE-LKPKBOIGSA-N
167327
PDB entries from 2020-08-05