BU3

?

Summary

Name:(R,R)-2,3-BUTANEDIOL
Formula:C4 H10 O2
Formal charge:0
Molecular weight:90.121 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs10.04(2R,3R)-butane-2,3-diol
OpenEye OEToolkits1.5.0(2R,3R)-butane-2,3-diol

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04OC(C)C(O)C
SMILES_CANONICALCACTVS3.341C[C@@H](O)[C@@H](C)O
SMILESCACTVS3.341C[CH](O)[CH](C)O
SMILES_CANONICALOpenEye OEToolkits1.5.0C[C@H]([C@@H](C)O)O
SMILESOpenEye OEToolkits1.5.0CC(C(C)O)O
InChIInChI1.03InChI=1S/C4H10O2/c1-3(5)4(2)6/h3-6H,1-2H3/t3-,4-/m1/s1
InChIKeyInChI1.03OWBTYPJTUOEWEK-QWWZWVQMSA-N