BFR

?

Summary

Name:N-butyl-N'-(diaminomethylidene)guanidine
Synonyms:Buformin
Formula:C6 H15 N5
Formal charge:0
Molecular weight:157.217 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs12.01N-butyl-N'-(diaminomethylidene)guanidine
OpenEye OEToolkits2.0.61-[bis(azanyl)methylidene]-3-butyl-guanidine

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01C(C)CCN\C(=N)\N=C(/N)N
InChIInChI1.03InChI=1S/C6H15N5/c1-2-3-4-10-6(9)11-5(7)8/h2-4H2,1H3,(H6,7,8,9,10,11)
InChIKeyInChI1.03XSEUMFJMFFMCIU-UHFFFAOYSA-N
SMILES_CANONICALCACTVS3.385CCCCNC(=N)N=C(N)N
SMILESCACTVS3.385CCCCNC(=N)N=C(N)N
SMILES_CANONICALOpenEye OEToolkits2.0.6[H]/N=C(\NCCCC)/N=C(N)N
SMILESOpenEye OEToolkits2.0.6CCCCNC(=N)N=C(N)N
167518
PDB entries from 2020-08-12