API

?

Summary

Name:2,6-DIAMINOPIMELIC ACID
Formula:C7 H14 N2 O4
Formal charge:0
Molecular weight:190.197 Da
Component type:L-PEPTIDE LINKING

Chemical Identifiers

ProgramVersionName
ACDLabs12.01(2R,6S)-2,6-diaminoheptanedioic acid
OpenEye OEToolkits1.7.2(2S,6R)-2,6-bis(azanyl)heptanedioic acid

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01O=C(O)C(N)CCCC(C(=O)O)N
InChIInChI1.03InChI=1S/C7H14N2O4/c8-4(6(10)11)2-1-3-5(9)7(12)13/h4-5H,1-3,8-9H2,(H,10,11)(H,12,13)/t4-,5+
InChIKeyInChI1.03GMKMEZVLHJARHF-SYDPRGILSA-N
SMILES_CANONICALCACTVS3.370N[C@@H](CCC[C@@H](N)C(O)=O)C(O)=O
SMILESCACTVS3.370N[CH](CCC[CH](N)C(O)=O)C(O)=O
SMILES_CANONICALOpenEye OEToolkits1.7.2C(C[C@H](C(=O)O)N)C[C@@H](C(=O)O)N
SMILESOpenEye OEToolkits1.7.2C(CC(C(=O)O)N)CC(C(=O)O)N
171916
PDB entries from 2020-12-02