ALE

?

Summary

Name:L-EPINEPHRINE
Synonyms:ADRENALINE
Formula:C9 H13 N O3
Formal charge:0
Molecular weight:183.204 Da
Component type:non-polymer

Chemical Identifiers

ProgramVersionName
OpenEye OEToolkits1.7.64-[(1R)-2-(methylamino)-1-oxidanyl-ethyl]benzene-1,2-diol

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01Oc1ccc(cc1O)C(O)CNC
InChIInChI1.03InChI=1S/C9H13NO3/c1-10-5-9(13)6-2-3-7(11)8(12)4-6/h2-4,9-13H,5H2,1H3/t9-/m0/s1
InChIKeyInChI1.03UCTWMZQNUQWSLP-VIFPVBQESA-N
SMILES_CANONICALCACTVS3.370CNC[C@H](O)c1ccc(O)c(O)c1
SMILESCACTVS3.370CNC[CH](O)c1ccc(O)c(O)c1
SMILES_CANONICALOpenEye OEToolkits1.7.6CNC[C@@H](c1ccc(c(c1)O)O)O
SMILESOpenEye OEToolkits1.7.6CNCC(c1ccc(c(c1)O)O)O