AE5

?

Summary

Name:N-[(2S)-2-amino-2-carboxyethyl]-L-glutamic acid
Formula:C8 H14 N2 O6
Formal charge:0
Molecular weight:234.207 Da
Component type:L-PEPTIDE LINKING

Chemical Identifiers

ProgramVersionName
ACDLabs12.01N-[(2S)-2-amino-2-carboxyethyl]-L-glutamic acid
OpenEye OEToolkits1.7.6(2S)-2-[[(2S)-2-azanyl-3-oxidanyl-3-oxidanylidene-propyl]amino]pentanedioic acid

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs12.01O=C(O)C(N)CNC(C(=O)O)CCC(=O)O
InChIInChI1.03InChI=1S/C8H14N2O6/c9-4(7(13)14)3-10-5(8(15)16)1-2-6(11)12/h4-5,10H,1-3,9H2,(H,11,12)(H,13,14)(H,15,16)/t4-,5-/m0/s1
InChIKeyInChI1.03XYQHCOGLGSNTNV-WHFBIAKZSA-N
SMILES_CANONICALCACTVS3.385N[C@@H](CN[C@@H](CCC(O)=O)C(O)=O)C(O)=O
SMILESCACTVS3.385N[CH](CN[CH](CCC(O)=O)C(O)=O)C(O)=O
SMILES_CANONICALOpenEye OEToolkits1.7.6C(CC(=O)O)[C@@H](C(=O)O)NC[C@@H](C(=O)O)N
SMILESOpenEye OEToolkits1.7.6C(CC(=O)O)C(C(=O)O)NCC(C(=O)O)N