AC6

?

Summary

Name:P-HYDROXYACETOPHENONE
Formula:C8 H8 O2
Formal charge:0
Molecular weight:136.148 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs10.041-(4-hydroxyphenyl)ethanone
OpenEye OEToolkits1.5.01-(4-hydroxyphenyl)ethanone

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04O=C(c1ccc(O)cc1)C
SMILES_CANONICALCACTVS3.341CC(=O)c1ccc(O)cc1
SMILESCACTVS3.341CC(=O)c1ccc(O)cc1
SMILES_CANONICALOpenEye OEToolkits1.5.0CC(=O)c1ccc(cc1)O
SMILESOpenEye OEToolkits1.5.0CC(=O)c1ccc(cc1)O
InChIInChI1.03InChI=1S/C8H8O2/c1-6(9)7-2-4-8(10)5-3-7/h2-5,10H,1H3
InChIKeyInChI1.03TXFPEBPIARQUIG-UHFFFAOYSA-N