8VH

?

Summary

Name:1,3-dimethylbenzene
Formula:C8 H10
Formal charge:0
Molecular weight:106.165 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
OpenEye OEToolkits2.0.61,3-dimethylbenzene

Chemical Descriptors

TypeProgramVersionDescriptor
InChIInChI1.03InChI=1S/C8H10/c1-7-4-3-5-8(2)6-7/h3-6H,1-2H3
InChIKeyInChI1.03IVSZLXZYQVIEFR-UHFFFAOYSA-N
SMILES_CANONICALCACTVS3.385Cc1cccc(C)c1
SMILESCACTVS3.385Cc1cccc(C)c1
SMILES_CANONICALOpenEye OEToolkits2.0.6Cc1cccc(c1)C
SMILESOpenEye OEToolkits2.0.6Cc1cccc(c1)C