6CL

?

Summary

Name:6-CARBOXYLYSINE
Formula:C7 H15 N2 O4
Formal charge:1
Molecular weight:191.205 Da
Component type:L-PEPTIDE LINKING

Chemical Identifiers

ProgramVersionName
ACDLabs10.04(1R,5S)-5-amino-1,5-dicarboxypentan-1-aminium
OpenEye OEToolkits1.5.0[(2R,6S)-6-amino-1,7-dihydroxy-1,7-dioxo-heptan-2-yl]azanium

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04O=C(O)C(CCCC(N)C(=O)O)[NH3+]
SMILES_CANONICALCACTVS3.341N[C@@H](CCC[C@@H]([NH3+])C(O)=O)C(O)=O
SMILESCACTVS3.341N[CH](CCC[CH]([NH3+])C(O)=O)C(O)=O
SMILES_CANONICALOpenEye OEToolkits1.5.0C(C[C@H](C(=O)O)[NH3+])C[C@@H](C(=O)O)N
SMILESOpenEye OEToolkits1.5.0C(CC(C(=O)O)[NH3+])CC(C(=O)O)N
InChIInChI1.03InChI=1S/C7H14N2O4/c8-4(6(10)11)2-1-3-5(9)7(12)13/h4-5H,1-3,8-9H2,(H,10,11)(H,12,13)/p+1/t4-,5+
InChIKeyInChI1.03GMKMEZVLHJARHF-SYDPRGILSA-O
171916
PDB entries from 2020-12-02