3HP

?

Summary

Name:3-HYDROXYPHENYLACETATE
Formula:C8 H8 O3
Formal charge:0
Molecular weight:152.147 Da
Component type:NON-POLYMER

Chemical Identifiers

ProgramVersionName
ACDLabs10.04(3-hydroxyphenyl)acetic acid
OpenEye OEToolkits1.5.02-(3-hydroxyphenyl)ethanoic acid

Chemical Descriptors

TypeProgramVersionDescriptor
SMILESACDLabs10.04O=C(O)Cc1cc(O)ccc1
SMILES_CANONICALCACTVS3.341OC(=O)Cc1cccc(O)c1
SMILESCACTVS3.341OC(=O)Cc1cccc(O)c1
SMILES_CANONICALOpenEye OEToolkits1.5.0c1cc(cc(c1)O)CC(=O)O
SMILESOpenEye OEToolkits1.5.0c1cc(cc(c1)O)CC(=O)O
InChIInChI1.03InChI=1S/C8H8O3/c9-7-3-1-2-6(4-7)5-8(10)11/h1-4,9H,5H2,(H,10,11)
InChIKeyInChI1.03FVMDYYGIDFPZAX-UHFFFAOYSA-N
171588
PDB entries from 2020-11-25